About 2-aminoethanol;2-chlorobenzoic acid
2-aminoethanol;2-chlorobenzoic acid (PubChem CID 86075909) has the molecular formula C9H12ClNO3
and a molecular weight of 217.65 g/mol. Its IUPAC name is 2-aminoethanol;2-chlorobenzoic acid.
Molecular Properties
| Compound Name | 2-aminoethanol;2-chlorobenzoic acid |
| PubChem CID | 86075909 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-aminoethanol;2-chlorobenzoic acid |
| SMILES | NCCO.O=C(O)c1ccccc1Cl |
| InChI | InChI=1S/C7H5ClO2.C2H7NO/c8-6-4-2-1-3-5(6)7(9)10;3-1-2-4/h1-4H,(H,9,10);4H,1-3H2 |
| InChIKey | UYQOEJMJOSUXSW-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoethanol;2-chlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-chlorobenzoic acid?
The IUPAC name of 2-aminoethanol;2-chlorobenzoic acid (CID 86075909) is 2-aminoethanol;2-chlorobenzoic acid.
What is the SMILES notation for 2-aminoethanol;2-chlorobenzoic acid?
The canonical SMILES for 2-aminoethanol;2-chlorobenzoic acid is NCCO.O=C(O)c1ccccc1Cl.
What is the InChIKey of 2-aminoethanol;2-chlorobenzoic acid?
The InChIKey is UYQOEJMJOSUXSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClO2.C2H7NO/c8-6-4-2-1-3-5(6)7(9)10;3-1-2-4/h1-4H,(H,9,10);4H,1-3H2.
What are the key properties of 2-aminoethanol;2-chlorobenzoic acid?
2-aminoethanol;2-chlorobenzoic acid has a molecular weight of 217.65 g/mol, XLogP of 0.98, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-chlorobenzoic acid is sourced from PubChem (CID 86075909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).