C30H24O6 — CID 132961918
dimethyl (1S,8R,11R,12R)-11,12-dibenzoyltricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9,10-dicarboxylate (PubChem CID 132961918) has the molecular formula C30H24O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is dimethyl (1S,8R,11R,12R)-11,12-dibenzoyltricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,8R,11R,12R)-11,12-dibenzoyltricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 132961918 |
| Molecular Formula | C30H24O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | dimethyl (1S,8R,11R,12R)-11,12-dibenzoyltricyclo[6.2.2.02,7]dodeca-2,4,6,9-tetraene-9,10-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H]2c3ccccc3[C@@H]1[C@@H](C(=O)c1ccccc1)[C@@H]2C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H24O6/c1-35-29(33)25-21-19-15-9-10-16-20(19)22(26(25)30(34)36-2)24(28(32)18-13-7-4-8-14-18)23(21)27(31)17-11-5-3-6-12-17/h3-16,21-24H,1-2H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | FROWKIAPVSVCGC-UEQSERJNSA-N |
| XLogP | 4.52 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |