C42H30O6 — CID 99693783
phenyl-[(1S,5R,6S,7R,8R,12S,13R,14R)-7,13,14-tribenzoyl-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-trien-6-yl]methanone (PubChem CID 99693783) has the molecular formula C42H30O6 and a molecular weight of 630.70 g/mol. Its IUPAC name is phenyl-[(1S,5R,6S,7R,8R,12S,13R,14R)-7,13,14-tribenzoyl-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-trien-6-yl]methanone.
| Compound Name | phenyl-[(1S,5R,6S,7R,8R,12S,13R,14R)-7,13,14-tribenzoyl-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-trien-6-yl]methanone |
|---|---|
| PubChem CID | 99693783 |
| Molecular Formula | C42H30O6 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | phenyl-[(1S,5R,6S,7R,8R,12S,13R,14R)-7,13,14-tribenzoyl-15,16-dioxapentacyclo[10.2.1.15,8.02,11.04,9]hexadeca-2(11),3,9-trien-6-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@@H]1[C@@H](C(=O)c2ccccc2)[C@@H]2O[C@@H]1c1cc3c(cc12)[C@@H]1O[C@@H]3[C@H](C(=O)c2ccccc2)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C42H30O6/c43-35(23-13-5-1-6-14-23)31-32(36(44)24-15-7-2-8-16-24)40-28-22-30-29(21-27(28)39(31)47-40)41-33(37(45)25-17-9-3-10-18-25)34(42(30)48-41)38(46)26-19-11-4-12-20-26/h1-22,31-34,39-42H/t31-,32-,33-,34+,39+,40+,41-,42-/m0/s1 |
| InChIKey | BRXSUDPDZCGKBW-LULIQDRZSA-N |
| XLogP | 7.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |