C10H9NO3 — CID 22806306
(2S,3S)-3-benzoyloxirane-2-carboxamide (PubChem CID 22806306) has the molecular formula C10H9NO3 and a molecular weight of 191.19 g/mol. Its IUPAC name is (2S,3S)-3-benzoyloxirane-2-carboxamide.
| Compound Name | (2S,3S)-3-benzoyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 22806306 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (2S,3S)-3-benzoyloxirane-2-carboxamide |
| SMILES | NC(=O)[C@H]1O[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H9NO3/c11-10(13)9-8(14-9)7(12)6-4-2-1-3-5-6/h1-5,8-9H,(H2,11,13)/t8-,9+/m1/s1 |
| InChIKey | QEXFYQKPZMEVPJ-BDAKNGLRSA-N |
| XLogP | 0.12 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|