C12H12O2 — CID 131845340
phenyl-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]methanone (PubChem CID 131845340) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is phenyl-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]methanone.
| Compound Name | phenyl-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 131845340 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | phenyl-[(2R,3S)-3-[(E)-prop-1-enyl]oxiran-2-yl]methanone |
| SMILES | C/C=C/[C@@H]1O[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12O2/c1-2-6-10-12(14-10)11(13)9-7-4-3-5-8-9/h2-8,10,12H,1H3/b6-2+/t10-,12+/m0/s1 |
| InChIKey | LIYSPDHXPRDQGM-SHLDSEAOSA-N |
| XLogP | 2.21 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|