C10H10O3 — CID 101254811
[(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-phenylmethanone (PubChem CID 101254811) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is [(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-phenylmethanone.
| Compound Name | [(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 101254811 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | [(2S,3S)-3-(hydroxymethyl)oxiran-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1O[C@H]1CO |
| InChI | InChI=1S/C10H10O3/c11-6-8-10(13-8)9(12)7-4-2-1-3-5-7/h1-5,8,10-11H,6H2/t8-,10-/m0/s1 |
| InChIKey | VQVFZYUNMUDVBV-WPRPVWTQSA-N |
| XLogP | 0.63 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|