C24H18O4 — CID 135504692
[(2S,3R)-3-[4-[(2S,3S)-3-benzoyloxiran-2-yl]phenyl]oxiran-2-yl]-phenylmethanone (PubChem CID 135504692) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is [(2S,3R)-3-[4-[(2S,3S)-3-benzoyloxiran-2-yl]phenyl]oxiran-2-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-3-[4-[(2S,3S)-3-benzoyloxiran-2-yl]phenyl]oxiran-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135504692 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(2S,3R)-3-[4-[(2S,3S)-3-benzoyloxiran-2-yl]phenyl]oxiran-2-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@H]1O[C@@H]1c1ccc([C@@H]2O[C@@H]2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H18O4/c25-19(15-7-3-1-4-8-15)23-21(27-23)17-11-13-18(14-12-17)22-24(28-22)20(26)16-9-5-2-6-10-16/h1-14,21-24H/t21-,22+,23-,24-/m1/s1 |
| InChIKey | LSPQXJQSYLGKQO-UEQSERJNSA-N |
| XLogP | 4.33 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|