C32H22O4 — CID 10766739
[(2R,3S)-3-[4-[(2S,3R)-3-(naphthalene-2-carbonyl)oxiran-2-yl]phenyl]oxiran-2-yl]-naphthalen-2-ylmethanone (PubChem CID 10766739) has the molecular formula C32H22O4 and a molecular weight of 470.52 g/mol. Its IUPAC name is [(2R,3S)-3-[4-[(2S,3R)-3-(naphthalene-2-carbonyl)oxiran-2-yl]phenyl]oxiran-2-yl]-naphthalen-2-ylmethanone.
| Compound Name | [(2R,3S)-3-[4-[(2S,3R)-3-(naphthalene-2-carbonyl)oxiran-2-yl]phenyl]oxiran-2-yl]-naphthalen-2-ylmethanone |
|---|---|
| PubChem CID | 10766739 |
| Molecular Formula | C32H22O4 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(2R,3S)-3-[4-[(2S,3R)-3-(naphthalene-2-carbonyl)oxiran-2-yl]phenyl]oxiran-2-yl]-naphthalen-2-ylmethanone |
| SMILES | O=C(c1ccc2ccccc2c1)[C@@H]1O[C@H]1c1ccc([C@@H]2O[C@H]2C(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C32H22O4/c33-27(25-15-9-19-5-1-3-7-23(19)17-25)31-29(35-31)21-11-13-22(14-12-21)30-32(36-30)28(34)26-16-10-20-6-2-4-8-24(20)18-26/h1-18,29-32H/t29-,30-,31-,32-/m0/s1 |
| InChIKey | CITFSISDHWCHAF-YDPTYEFTSA-N |
| XLogP | 6.64 |
| TPSA | 59.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|