About phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone
phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone (PubChem CID 16753146) has the molecular formula C16H11F3O2
and a molecular weight of 292.26 g/mol. Its IUPAC name is phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone.
Molecular Properties
| Compound Name | phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone |
| PubChem CID | 16753146 |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone |
| SMILES | O=C(c1ccccc1)[C@H]1O[C@@H]1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H11F3O2/c17-16(18,19)12-8-6-11(7-9-12)14-15(21-14)13(20)10-4-2-1-3-5-10/h1-9,14-15H/t14-,15-/m1/s1 |
| InChIKey | LYCOKVLILKDINA-HUUCEWRRSA-N |
| XLogP | 4.03 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone?
The IUPAC name of phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone (CID 16753146) is phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone.
What is the SMILES notation for phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone?
The canonical SMILES for phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone is O=C(c1ccccc1)[C@H]1O[C@@H]1c1ccc(C(F)(F)F)cc1.
What is the InChIKey of phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone?
The InChIKey is LYCOKVLILKDINA-HUUCEWRRSA-N. The full InChI is InChI=1S/C16H11F3O2/c17-16(18,19)12-8-6-11(7-9-12)14-15(21-14)13(20)10-4-2-1-3-5-10/h1-9,14-15H/t14-,15-/m1/s1.
What are the key properties of phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone?
phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone has a molecular weight of 292.26 g/mol, XLogP of 4.03, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[(2S,3R)-3-[4-(trifluoromethyl)phenyl]oxiran-2-yl]methanone is sourced from PubChem (CID 16753146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).