C11H12O4 — CID 174518097
(2,4-dihydroxyoxolan-3-yl)-phenylmethanone (PubChem CID 174518097) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2,4-dihydroxyoxolan-3-yl)-phenylmethanone.
| Compound Name | (2,4-dihydroxyoxolan-3-yl)-phenylmethanone |
|---|---|
| PubChem CID | 174518097 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (2,4-dihydroxyoxolan-3-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1C(O)COC1O |
| InChI | InChI=1S/C11H12O4/c12-8-6-15-11(14)9(8)10(13)7-4-2-1-3-5-7/h1-5,8-9,11-12,14H,6H2 |
| InChIKey | WUOIHQOUHIIZIQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |