C19H18O3 — CID 150172119
2-methyl-2-(oxiran-2-ylmethyl)-1,3-diphenylpropane-1,3-dione (PubChem CID 150172119) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-methyl-2-(oxiran-2-ylmethyl)-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-methyl-2-(oxiran-2-ylmethyl)-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 150172119 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 2-methyl-2-(oxiran-2-ylmethyl)-1,3-diphenylpropane-1,3-dione |
| SMILES | CC(CC1CO1)(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-19(12-16-13-22-16,17(20)14-8-4-2-5-9-14)18(21)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3 |
| InChIKey | FJQOSHXTOMYYKA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|