About S-(oxiran-2-ylmethyl) benzenecarbothioate
S-(oxiran-2-ylmethyl) benzenecarbothioate (PubChem CID 21321039) has the molecular formula C10H10O2S
and a molecular weight of 194.26 g/mol. Its IUPAC name is S-(oxiran-2-ylmethyl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(oxiran-2-ylmethyl) benzenecarbothioate |
| PubChem CID | 21321039 |
| Molecular Formula | C10H10O2S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | S-(oxiran-2-ylmethyl) benzenecarbothioate |
| SMILES | O=C(SCC1CO1)c1ccccc1 |
| InChI | InChI=1S/C10H10O2S/c11-10(13-7-9-6-12-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | BGQZKEMPGYRMQM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze S-(oxiran-2-ylmethyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(oxiran-2-ylmethyl) benzenecarbothioate?
The IUPAC name of S-(oxiran-2-ylmethyl) benzenecarbothioate (CID 21321039) is S-(oxiran-2-ylmethyl) benzenecarbothioate.
What is the SMILES notation for S-(oxiran-2-ylmethyl) benzenecarbothioate?
The canonical SMILES for S-(oxiran-2-ylmethyl) benzenecarbothioate is O=C(SCC1CO1)c1ccccc1.
What is the InChIKey of S-(oxiran-2-ylmethyl) benzenecarbothioate?
The InChIKey is BGQZKEMPGYRMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2S/c11-10(13-7-9-6-12-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2.
What are the key properties of S-(oxiran-2-ylmethyl) benzenecarbothioate?
S-(oxiran-2-ylmethyl) benzenecarbothioate has a molecular weight of 194.26 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(oxiran-2-ylmethyl) benzenecarbothioate is sourced from PubChem (CID 21321039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).