About S-(3-aminopropyl) benzenecarbothioate
S-(3-aminopropyl) benzenecarbothioate (PubChem CID 71402866) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is S-(3-aminopropyl) benzenecarbothioate.
Molecular Properties
| Compound Name | S-(3-aminopropyl) benzenecarbothioate |
| PubChem CID | 71402866 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | S-(3-aminopropyl) benzenecarbothioate |
| SMILES | NCCCSC(=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NOS/c11-7-4-8-13-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2 |
| InChIKey | OSGYUKDUKLQGAL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(3-aminopropyl) benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(3-aminopropyl) benzenecarbothioate?
The IUPAC name of S-(3-aminopropyl) benzenecarbothioate (CID 71402866) is S-(3-aminopropyl) benzenecarbothioate.
What is the SMILES notation for S-(3-aminopropyl) benzenecarbothioate?
The canonical SMILES for S-(3-aminopropyl) benzenecarbothioate is NCCCSC(=O)c1ccccc1.
What is the InChIKey of S-(3-aminopropyl) benzenecarbothioate?
The InChIKey is OSGYUKDUKLQGAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NOS/c11-7-4-8-13-10(12)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8,11H2.
What are the key properties of S-(3-aminopropyl) benzenecarbothioate?
S-(3-aminopropyl) benzenecarbothioate has a molecular weight of 195.29 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(3-aminopropyl) benzenecarbothioate is sourced from PubChem (CID 71402866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).