C18H25N5O5S — CID 90452282
S-[2-[[2-[[2-[[2-(3-aminopropylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate (PubChem CID 90452282) has the molecular formula C18H25N5O5S and a molecular weight of 423.50 g/mol. Its IUPAC name is S-[2-[[2-[[2-[[2-(3-aminopropylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate.
| Compound Name | S-[2-[[2-[[2-[[2-(3-aminopropylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 90452282 |
| Molecular Formula | C18H25N5O5S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | S-[2-[[2-[[2-[[2-(3-aminopropylamino)-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate |
| SMILES | NCCCNC(=O)CNC(=O)CNC(=O)CNC(=O)CSC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25N5O5S/c19-7-4-8-20-14(24)9-21-15(25)10-22-16(26)11-23-17(27)12-29-18(28)13-5-2-1-3-6-13/h1-3,5-6H,4,7-12,19H2,(H,20,24)(H,21,25)(H,22,26)(H,23,27) |
| InChIKey | MOWZEGQURBGWNN-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|