C15H16N3NaO6S — CID 88657381
sodium 2-[[2-[[2-[(2-benzoylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate (PubChem CID 88657381) has the molecular formula C15H16N3NaO6S and a molecular weight of 389.37 g/mol. Its IUPAC name is sodium 2-[[2-[[2-[(2-benzoylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate.
| Compound Name | sodium 2-[[2-[[2-[(2-benzoylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 88657381 |
| Molecular Formula | C15H16N3NaO6S |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | sodium 2-[[2-[[2-[(2-benzoylsulfanylacetyl)amino]acetyl]amino]acetyl]amino]acetate |
| SMILES | O=C([O-])CNC(=O)CNC(=O)CNC(=O)CSC(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C15H17N3O6S.Na/c19-11(16-6-12(20)18-8-14(22)23)7-17-13(21)9-25-15(24)10-4-2-1-3-5-10;/h1-5H,6-9H2,(H,16,19)(H,17,21)(H,18,20)(H,22,23);/q;+1/p-1 |
| InChIKey | QPRSZTQMTNRIRD-UHFFFAOYSA-M |
| XLogP | -5.34 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | -5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|