C24H26N2O5S2 — CID 118604279
S-[2-[[2-[(2-benzoylsulfanylacetyl)amino]-4-methyl-3-oxopentyl]amino]-2-oxoethyl] benzenecarbothioate (PubChem CID 118604279) has the molecular formula C24H26N2O5S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is S-[2-[[2-[(2-benzoylsulfanylacetyl)amino]-4-methyl-3-oxopentyl]amino]-2-oxoethyl] benzenecarbothioate.
| Compound Name | S-[2-[[2-[(2-benzoylsulfanylacetyl)amino]-4-methyl-3-oxopentyl]amino]-2-oxoethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 118604279 |
| Molecular Formula | C24H26N2O5S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | S-[2-[[2-[(2-benzoylsulfanylacetyl)amino]-4-methyl-3-oxopentyl]amino]-2-oxoethyl] benzenecarbothioate |
| SMILES | CC(C)C(=O)C(CNC(=O)CSC(=O)c1ccccc1)NC(=O)CSC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O5S2/c1-16(2)22(29)19(26-21(28)15-33-24(31)18-11-7-4-8-12-18)13-25-20(27)14-32-23(30)17-9-5-3-6-10-17/h3-12,16,19H,13-15H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | GRVLLVVFLKJLGI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|