C28H31N3O3S — CID 59620966
S-[(2S)-3-[[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]amino]-2-benzamidopropyl] benzenecarbothioate (PubChem CID 59620966) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is S-[(2S)-3-[[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]amino]-2-benzamidopropyl] benzenecarbothioate.
| Compound Name | S-[(2S)-3-[[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]amino]-2-benzamidopropyl] benzenecarbothioate |
|---|---|
| PubChem CID | 59620966 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | S-[(2S)-3-[[(2S)-1-anilino-3-methyl-1-oxobutan-2-yl]amino]-2-benzamidopropyl] benzenecarbothioate |
| SMILES | CC(C)[C@H](NC[C@@H](CSC(=O)c1ccccc1)NC(=O)c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H31N3O3S/c1-20(2)25(27(33)30-23-16-10-5-11-17-23)29-18-24(31-26(32)21-12-6-3-7-13-21)19-35-28(34)22-14-8-4-9-15-22/h3-17,20,24-25,29H,18-19H2,1-2H3,(H,30,33)(H,31,32)/t24-,25-/m0/s1 |
| InChIKey | QJNGUNZTULLAGM-DQEYMECFSA-N |
| XLogP | 4.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|