C22H23NO5S2 — CID 54176724
(2S)-2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoic acid (PubChem CID 54176724) has the molecular formula C22H23NO5S2 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 54176724 |
| Molecular Formula | C22H23NO5S2 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (2S)-2-[[(2R)-2,3-bis(benzoylsulfanyl)propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CSC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H23NO5S2/c1-14(2)18(20(25)26)23-19(24)17(30-22(28)16-11-7-4-8-12-16)13-29-21(27)15-9-5-3-6-10-15/h3-12,14,17-18H,13H2,1-2H3,(H,23,24)(H,25,26)/t17-,18-/m0/s1 |
| InChIKey | OYXJBLWOYLKCRM-ROUUACIJSA-N |
| XLogP | 3.73 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|