C26H28N2O8S2 — CID 10007972
methyl 3-benzoylsulfanyl-4-[2-[(2-benzoylsulfanyl-4-methoxy-4-oxobutanoyl)amino]ethylamino]-4-oxobutanoate (PubChem CID 10007972) has the molecular formula C26H28N2O8S2 and a molecular weight of 560.65 g/mol. Its IUPAC name is methyl 3-benzoylsulfanyl-4-[2-[(2-benzoylsulfanyl-4-methoxy-4-oxobutanoyl)amino]ethylamino]-4-oxobutanoate.
| Compound Name | methyl 3-benzoylsulfanyl-4-[2-[(2-benzoylsulfanyl-4-methoxy-4-oxobutanoyl)amino]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 10007972 |
| Molecular Formula | C26H28N2O8S2 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | methyl 3-benzoylsulfanyl-4-[2-[(2-benzoylsulfanyl-4-methoxy-4-oxobutanoyl)amino]ethylamino]-4-oxobutanoate |
| SMILES | COC(=O)CC(SC(=O)c1ccccc1)C(=O)NCCNC(=O)C(CC(=O)OC)SC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H28N2O8S2/c1-35-21(29)15-19(37-25(33)17-9-5-3-6-10-17)23(31)27-13-14-28-24(32)20(16-22(30)36-2)38-26(34)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | RNDZFXARPGCUDG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|