2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid

C19H17NO5S2 — CID 13322357

IUPAC2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid
SMILESCC(NC(=O)C(SC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C19H17NO5S2/c1-12(16(22)23)20-15(21)19(26-17(24)13-8-4-2-5-9-13)27-18(25)14-10-6-3-7-11-14/h2-12,19H,1H3,(H,20,21)(H,22,23)
InChIKeyQMQVQIJZQDXTIQ-UHFFFAOYSA-N
MW403.48 g/mol
LogP3.05
Rot. Bonds7

About 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid

2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid (PubChem CID 13322357) has the molecular formula C19H17NO5S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid.

Molecular Properties

Compound Name2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid
PubChem CID13322357
Molecular FormulaC19H17NO5S2
Molecular Weight403.48 g/mol
Exact Mass403.05
IUPAC Name2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid
SMILESCC(NC(=O)C(SC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O
InChIInChI=1S/C19H17NO5S2/c1-12(16(22)23)20-15(21)19(26-17(24)13-8-4-2-5-9-13)27-18(25)14-10-6-3-7-11-14/h2-12,19H,1H3,(H,20,21)(H,22,23)
InChIKeyQMQVQIJZQDXTIQ-UHFFFAOYSA-N
XLogP3.05
TPSA100.54 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms27
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500403.48
LogP ≤ 53.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid?
The IUPAC name of 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid (CID 13322357) is 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid.
What is the SMILES notation for 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid?
The canonical SMILES for 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid is CC(NC(=O)C(SC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O.
What is the InChIKey of 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid?
The InChIKey is QMQVQIJZQDXTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5S2/c1-12(16(22)23)20-15(21)19(26-17(24)13-8-4-2-5-9-13)27-18(25)14-10-6-3-7-11-14/h2-12,19H,1H3,(H,20,21)(H,22,23).
What are the key properties of 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid?
2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid has a molecular weight of 403.48 g/mol, XLogP of 3.05, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2,2-bis(benzoylsulfanyl)acetyl]amino]propanoic acid is sourced from PubChem (CID 13322357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).