C15H20N2O5 — CID 153078663
(2S)-2-[[(2S)-2-(benzoyloxyamino)-3-methylbutanoyl]amino]propanoic acid (PubChem CID 153078663) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(benzoyloxyamino)-3-methylbutanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(benzoyloxyamino)-3-methylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 153078663 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | (2S)-2-[[(2S)-2-(benzoyloxyamino)-3-methylbutanoyl]amino]propanoic acid |
| SMILES | CC(C)[C@H](NOC(=O)c1ccccc1)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H20N2O5/c1-9(2)12(13(18)16-10(3)14(19)20)17-22-15(21)11-7-5-4-6-8-11/h4-10,12,17H,1-3H3,(H,16,18)(H,19,20)/t10-,12-/m0/s1 |
| InChIKey | VMVFVBRDYJZHBZ-JQWIXIFHSA-N |
| XLogP | 0.96 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|