C19H18N2O5S — CID 18596175
(2S)-2-[(2-benzamido-2-benzoylsulfanylacetyl)amino]propanoic acid (PubChem CID 18596175) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (2S)-2-[(2-benzamido-2-benzoylsulfanylacetyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(2-benzamido-2-benzoylsulfanylacetyl)amino]propanoic acid |
|---|---|
| PubChem CID | 18596175 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (2S)-2-[(2-benzamido-2-benzoylsulfanylacetyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)C(NC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H18N2O5S/c1-12(18(24)25)20-16(23)17(21-15(22)13-8-4-2-5-9-13)27-19(26)14-10-6-3-7-11-14/h2-12,17H,1H3,(H,20,23)(H,21,22)(H,24,25)/t12-,17?/m0/s1 |
| InChIKey | MJFLZPUNHFWOIO-WHUIICBVSA-N |
| XLogP | 1.91 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|