C13H13NO5S — CID 126726084
(2S)-2-[(3-benzoylsulfanyl-2-oxopropanoyl)amino]propanoic acid (PubChem CID 126726084) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is (2S)-2-[(3-benzoylsulfanyl-2-oxopropanoyl)amino]propanoic acid.
| Compound Name | (2S)-2-[(3-benzoylsulfanyl-2-oxopropanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 126726084 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | (2S)-2-[(3-benzoylsulfanyl-2-oxopropanoyl)amino]propanoic acid |
| SMILES | C[C@H](NC(=O)C(=O)CSC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H13NO5S/c1-8(12(17)18)14-11(16)10(15)7-20-13(19)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | FGGKFHHTWVWMTD-QMMMGPOBSA-N |
| XLogP | 0.72 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|