C13H17ClN2O4S — CID 131876714
methyl 2-[[(2R)-2-amino-3-benzoylsulfanylpropanoyl]amino]acetate;hydrochloride (PubChem CID 131876714) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is methyl 2-[[(2R)-2-amino-3-benzoylsulfanylpropanoyl]amino]acetate;hydrochloride.
| Compound Name | methyl 2-[[(2R)-2-amino-3-benzoylsulfanylpropanoyl]amino]acetate;hydrochloride |
|---|---|
| PubChem CID | 131876714 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | methyl 2-[[(2R)-2-amino-3-benzoylsulfanylpropanoyl]amino]acetate;hydrochloride |
| SMILES | COC(=O)CNC(=O)[C@@H](N)CSC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C13H16N2O4S.ClH/c1-19-11(16)7-15-12(17)10(14)8-20-13(18)9-5-3-2-4-6-9;/h2-6,10H,7-8,14H2,1H3,(H,15,17);1H/t10-;/m0./s1 |
| InChIKey | CUUKDNCSUXJRCH-PPHPATTJSA-N |
| XLogP | 0.60 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|