C25H21NO5S2 — CID 18596168
(2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]-2-phenylacetic acid (PubChem CID 18596168) has the molecular formula C25H21NO5S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]-2-phenylacetic acid.
| Compound Name | (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 18596168 |
| Molecular Formula | C25H21NO5S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]-2-phenylacetic acid |
| SMILES | O=C(SCC(SC(=O)c1ccccc1)C(=O)N[C@H](C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21NO5S2/c27-22(26-21(23(28)29)17-10-4-1-5-11-17)20(33-25(31)19-14-8-3-9-15-19)16-32-24(30)18-12-6-2-7-13-18/h1-15,20-21H,16H2,(H,26,27)(H,28,29)/t20?,21-/m0/s1 |
| InChIKey | PHKNDMMPLFLNSR-LBAQZLPGSA-N |
| XLogP | 4.44 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|