C23H25NO5S2 — CID 88695667
(2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]hexanoic acid (PubChem CID 88695667) has the molecular formula C23H25NO5S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 88695667 |
| Molecular Formula | C23H25NO5S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | (2S)-2-[2,3-bis(benzoylsulfanyl)propanoylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)C(CSC(=O)c1ccccc1)SC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C23H25NO5S2/c1-2-3-14-18(21(26)27)24-20(25)19(31-23(29)17-12-8-5-9-13-17)15-30-22(28)16-10-6-4-7-11-16/h4-13,18-19H,2-3,14-15H2,1H3,(H,24,25)(H,26,27)/t18-,19?/m0/s1 |
| InChIKey | ZQPMGXYFDNHRSU-OYKVQYDMSA-N |
| XLogP | 4.26 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|