C26H33NO4S2 — CID 57185287
(2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[1-(4-tert-butylphenyl)ethylsulfanyl]propanoic acid (PubChem CID 57185287) has the molecular formula C26H33NO4S2 and a molecular weight of 487.69 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[1-(4-tert-butylphenyl)ethylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[1-(4-tert-butylphenyl)ethylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 57185287 |
| Molecular Formula | C26H33NO4S2 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[1-(4-tert-butylphenyl)ethylsulfanyl]propanoic acid |
| SMILES | CC(SC[C@H](NC(=O)[C@H](C)CSC(=O)c1ccccc1)C(=O)O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H33NO4S2/c1-17(15-33-25(31)20-9-7-6-8-10-20)23(28)27-22(24(29)30)16-32-18(2)19-11-13-21(14-12-19)26(3,4)5/h6-14,17-18,22H,15-16H2,1-5H3,(H,27,28)(H,29,30)/t17-,18?,22+/m1/s1 |
| InChIKey | YQSGIYDTZPFJOB-SLNGMPHYSA-N |
| XLogP | 5.56 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|