C24H29NO4S2 — CID 87879064
(2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-2-(2-methyl-1-phenylpropyl)sulfanylpropanoic acid (PubChem CID 87879064) has the molecular formula C24H29NO4S2 and a molecular weight of 459.63 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-2-(2-methyl-1-phenylpropyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-2-(2-methyl-1-phenylpropyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87879064 |
| Molecular Formula | C24H29NO4S2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-2-(2-methyl-1-phenylpropyl)sulfanylpropanoic acid |
| SMILES | CC(C)C(S[C@@](C)(NC(=O)[C@H](C)CSC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C24H29NO4S2/c1-16(2)20(18-11-7-5-8-12-18)31-24(4,23(28)29)25-21(26)17(3)15-30-22(27)19-13-9-6-10-14-19/h5-14,16-17,20H,15H2,1-4H3,(H,25,26)(H,28,29)/t17-,20?,24-/m1/s1 |
| InChIKey | DTAGKZWXHAZIBV-VLDIMPENSA-N |
| XLogP | 5.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|