C23H30N2O3S2 — CID 67589540
(2S)-2-[(3-benzylsulfanyl-2-methylpropanoyl)amino]-2-[[4-(dimethylamino)phenyl]methylsulfanyl]propanoic acid (PubChem CID 67589540) has the molecular formula C23H30N2O3S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is (2S)-2-[(3-benzylsulfanyl-2-methylpropanoyl)amino]-2-[[4-(dimethylamino)phenyl]methylsulfanyl]propanoic acid.
| Compound Name | (2S)-2-[(3-benzylsulfanyl-2-methylpropanoyl)amino]-2-[[4-(dimethylamino)phenyl]methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 67589540 |
| Molecular Formula | C23H30N2O3S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (2S)-2-[(3-benzylsulfanyl-2-methylpropanoyl)amino]-2-[[4-(dimethylamino)phenyl]methylsulfanyl]propanoic acid |
| SMILES | CC(CSCc1ccccc1)C(=O)N[C@@](C)(SCc1ccc(N(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C23H30N2O3S2/c1-17(14-29-15-18-8-6-5-7-9-18)21(26)24-23(2,22(27)28)30-16-19-10-12-20(13-11-19)25(3)4/h5-13,17H,14-16H2,1-4H3,(H,24,26)(H,27,28)/t17?,23-/m0/s1 |
| InChIKey | XQMWXWXZRVWPAF-VXLWULRPSA-N |
| XLogP | 4.47 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|