C29H37NO4S2 — CID 87879082
(2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[2-(4-cyclohexylphenyl)propan-2-ylsulfanyl]propanoic acid (PubChem CID 87879082) has the molecular formula C29H37NO4S2 and a molecular weight of 527.75 g/mol. Its IUPAC name is (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[2-(4-cyclohexylphenyl)propan-2-ylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[2-(4-cyclohexylphenyl)propan-2-ylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 87879082 |
| Molecular Formula | C29H37NO4S2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (2R)-2-[[(2S)-3-benzoylsulfanyl-2-methylpropanoyl]amino]-3-[2-(4-cyclohexylphenyl)propan-2-ylsulfanyl]propanoic acid |
| SMILES | C[C@H](CSC(=O)c1ccccc1)C(=O)N[C@@H](CSC(C)(C)c1ccc(C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C29H37NO4S2/c1-20(18-35-28(34)23-12-8-5-9-13-23)26(31)30-25(27(32)33)19-36-29(2,3)24-16-14-22(15-17-24)21-10-6-4-7-11-21/h5,8-9,12-17,20-21,25H,4,6-7,10-11,18-19H2,1-3H3,(H,30,31)(H,32,33)/t20-,25+/m1/s1 |
| InChIKey | LUCXOQJCFUDMSG-NLFFAJNJSA-N |
| XLogP | 6.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|