C19H29NO3S2 — CID 18797757
3-(2,2-dimethyl-1-phenylbutyl)sulfanyl-2-[(2-methyl-3-sulfanylpropanoyl)amino]propanoic acid (PubChem CID 18797757) has the molecular formula C19H29NO3S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1-phenylbutyl)sulfanyl-2-[(2-methyl-3-sulfanylpropanoyl)amino]propanoic acid.
| Compound Name | 3-(2,2-dimethyl-1-phenylbutyl)sulfanyl-2-[(2-methyl-3-sulfanylpropanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 18797757 |
| Molecular Formula | C19H29NO3S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-(2,2-dimethyl-1-phenylbutyl)sulfanyl-2-[(2-methyl-3-sulfanylpropanoyl)amino]propanoic acid |
| SMILES | CCC(C)(C)C(SCC(NC(=O)C(C)CS)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO3S2/c1-5-19(3,4)16(14-9-7-6-8-10-14)25-12-15(18(22)23)20-17(21)13(2)11-24/h6-10,13,15-16,24H,5,11-12H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | IOHWOHCZVOHDDW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|