C16H23N3O5S — CID 141214061
(2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-phenylacetyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 141214061) has the molecular formula C16H23N3O5S and a molecular weight of 369.44 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-phenylacetyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-phenylacetyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 141214061 |
| Molecular Formula | C16H23N3O5S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | (2S)-2-[[(2R)-2-[[2-(hydroxyamino)-2-phenylacetyl]amino]-3-sulfanylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CS)NC(=O)C(NO)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H23N3O5S/c1-9(2)12(16(22)23)18-14(20)11(8-25)17-15(21)13(19-24)10-6-4-3-5-7-10/h3-7,9,11-13,19,24-25H,8H2,1-2H3,(H,17,21)(H,18,20)(H,22,23)/t11-,12-,13?/m0/s1 |
| InChIKey | SMHGDNRMPLMIGI-VYAYZGMFSA-N |
| XLogP | 0.35 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|