C27H25NO5S2 — CID 13322382
2-[2,3-bis(benzoylsulfanyl)propanoylamino]-4-phenylbutanoic acid (PubChem CID 13322382) has the molecular formula C27H25NO5S2 and a molecular weight of 507.63 g/mol. Its IUPAC name is 2-[2,3-bis(benzoylsulfanyl)propanoylamino]-4-phenylbutanoic acid.
| Compound Name | 2-[2,3-bis(benzoylsulfanyl)propanoylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 13322382 |
| Molecular Formula | C27H25NO5S2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | 2-[2,3-bis(benzoylsulfanyl)propanoylamino]-4-phenylbutanoic acid |
| SMILES | O=C(SCC(SC(=O)c1ccccc1)C(=O)NC(CCc1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C27H25NO5S2/c29-24(28-22(25(30)31)17-16-19-10-4-1-5-11-19)23(35-27(33)21-14-8-3-9-15-21)18-34-26(32)20-12-6-2-7-13-20/h1-15,22-23H,16-18H2,(H,28,29)(H,30,31) |
| InChIKey | BYMJIIIGYNEDRI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|