C15H18N3O5S- — CID 59294796
N-[3-[2-[(2-benzoylsulfanylacetyl)amino]ethylamino]-2-oxopropyl]carbamate (PubChem CID 59294796) has the molecular formula C15H18N3O5S- and a molecular weight of 352.39 g/mol. Its IUPAC name is N-[3-[2-[(2-benzoylsulfanylacetyl)amino]ethylamino]-2-oxopropyl]carbamate.
| Compound Name | N-[3-[2-[(2-benzoylsulfanylacetyl)amino]ethylamino]-2-oxopropyl]carbamate |
|---|---|
| PubChem CID | 59294796 |
| Molecular Formula | C15H18N3O5S- |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[3-[2-[(2-benzoylsulfanylacetyl)amino]ethylamino]-2-oxopropyl]carbamate |
| SMILES | O=C(CNCCNC(=O)CSC(=O)c1ccccc1)CNC(=O)[O-] |
| InChI | InChI=1S/C15H19N3O5S/c19-12(9-18-15(22)23)8-16-6-7-17-13(20)10-24-14(21)11-4-2-1-3-5-11/h1-5,16,18H,6-10H2,(H,17,20)(H,22,23)/p-1 |
| InChIKey | HQAIKAQLACRZNT-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|