C28H31N3O6S2 — CID 139759617
S-[2-[2-[[2-(methanesulfonamido)-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate (PubChem CID 139759617) has the molecular formula C28H31N3O6S2 and a molecular weight of 569.71 g/mol. Its IUPAC name is S-[2-[2-[[2-(methanesulfonamido)-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate.
| Compound Name | S-[2-[2-[[2-(methanesulfonamido)-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 139759617 |
| Molecular Formula | C28H31N3O6S2 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | S-[2-[2-[[2-(methanesulfonamido)-3-(4-phenylmethoxyphenyl)propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate |
| SMILES | CS(=O)(=O)NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCNC(=O)CSC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31N3O6S2/c1-39(35,36)31-25(18-21-12-14-24(15-13-21)37-19-22-8-4-2-5-9-22)27(33)30-17-16-29-26(32)20-38-28(34)23-10-6-3-7-11-23/h2-15,25,31H,16-20H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | KPVDFOOYRUQHGA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|