C27H29N3O6S2 — CID 139759607
S-[2-[2-[[3-(4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate (PubChem CID 139759607) has the molecular formula C27H29N3O6S2 and a molecular weight of 555.68 g/mol. Its IUPAC name is S-[2-[2-[[3-(4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate.
| Compound Name | S-[2-[2-[[3-(4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 139759607 |
| Molecular Formula | C27H29N3O6S2 |
| Molecular Weight | 555.68 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | S-[2-[2-[[3-(4-hydroxyphenyl)-2-[(4-methylphenyl)sulfonylamino]propanoyl]amino]ethylamino]-2-oxoethyl] benzenecarbothioate |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccc(O)cc2)C(=O)NCCNC(=O)CSC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H29N3O6S2/c1-19-7-13-23(14-8-19)38(35,36)30-24(17-20-9-11-22(31)12-10-20)26(33)29-16-15-28-25(32)18-37-27(34)21-5-3-2-4-6-21/h2-14,24,30-31H,15-18H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | ZUAXVCJLPQZMFL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|