C25H28N2O3 — CID 131720927
(2S)-2-amino-N-(3-phenoxypropyl)-3-(4-phenylmethoxyphenyl)propanamide (PubChem CID 131720927) has the molecular formula C25H28N2O3 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-phenoxypropyl)-3-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-(3-phenoxypropyl)-3-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 131720927 |
| Molecular Formula | C25H28N2O3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | (2S)-2-amino-N-(3-phenoxypropyl)-3-(4-phenylmethoxyphenyl)propanamide |
| SMILES | N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCCOc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3/c26-24(25(28)27-16-7-17-29-22-10-5-2-6-11-22)18-20-12-14-23(15-13-20)30-19-21-8-3-1-4-9-21/h1-6,8-15,24H,7,16-19,26H2,(H,27,28)/t24-/m0/s1 |
| InChIKey | PYVQVXPOBCXHRH-DEOSSOPVSA-N |
| XLogP | 3.72 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|