C25H28ClNO2 — CID 67808775
(2S)-2-amino-6-phenyl-1-(4-phenylmethoxyphenyl)hexan-3-one;hydrochloride (PubChem CID 67808775) has the molecular formula C25H28ClNO2 and a molecular weight of 409.96 g/mol. Its IUPAC name is (2S)-2-amino-6-phenyl-1-(4-phenylmethoxyphenyl)hexan-3-one;hydrochloride.
| Compound Name | (2S)-2-amino-6-phenyl-1-(4-phenylmethoxyphenyl)hexan-3-one;hydrochloride |
|---|---|
| PubChem CID | 67808775 |
| Molecular Formula | C25H28ClNO2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S)-2-amino-6-phenyl-1-(4-phenylmethoxyphenyl)hexan-3-one;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C25H27NO2.ClH/c26-24(25(27)13-7-12-20-8-3-1-4-9-20)18-21-14-16-23(17-15-21)28-19-22-10-5-2-6-11-22;/h1-6,8-11,14-17,24H,7,12-13,18-19,26H2;1H/t24-;/m0./s1 |
| InChIKey | BYXZWWWAMGIONT-JIDHJSLPSA-N |
| XLogP | 5.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |