C26H39ClN2O2 — CID 67871370
(2R)-2-amino-N,N-dipentyl-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride (PubChem CID 67871370) has the molecular formula C26H39ClN2O2 and a molecular weight of 447.06 g/mol. Its IUPAC name is (2R)-2-amino-N,N-dipentyl-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride.
| Compound Name | (2R)-2-amino-N,N-dipentyl-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 67871370 |
| Molecular Formula | C26H39ClN2O2 |
| Molecular Weight | 447.06 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2R)-2-amino-N,N-dipentyl-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride |
| SMILES | CCCCCN(CCCCC)C(=O)[C@H](N)Cc1ccc(OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C26H38N2O2.ClH/c1-3-5-10-18-28(19-11-6-4-2)26(29)25(27)20-22-14-16-24(17-15-22)30-21-23-12-8-7-9-13-23;/h7-9,12-17,25H,3-6,10-11,18-21,27H2,1-2H3;1H/t25-;/m1./s1 |
| InChIKey | RYQNYYMRMDJSRK-VQIWEWKSSA-N |
| XLogP | 5.77 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.06 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|