C13H18ClNO3 — CID 67808687
(6S)-6-amino-5-oxo-7-phenylheptanoic acid;hydrochloride (PubChem CID 67808687) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is (6S)-6-amino-5-oxo-7-phenylheptanoic acid;hydrochloride.
| Compound Name | (6S)-6-amino-5-oxo-7-phenylheptanoic acid;hydrochloride |
|---|---|
| PubChem CID | 67808687 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | (6S)-6-amino-5-oxo-7-phenylheptanoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](Cc1ccccc1)C(=O)CCCC(=O)O |
| InChI | InChI=1S/C13H17NO3.ClH/c14-11(9-10-5-2-1-3-6-10)12(15)7-4-8-13(16)17;/h1-3,5-6,11H,4,7-9,14H2,(H,16,17);1H/t11-;/m0./s1 |
| InChIKey | FFUINULDXZAYHD-MERQFXBCSA-N |
| XLogP | 1.80 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |