C14H23N2O4P — CID 70545488
[(7R)-2,7-diamino-6-oxo-8-phenyloctyl]phosphonic acid (PubChem CID 70545488) has the molecular formula C14H23N2O4P and a molecular weight of 314.32 g/mol. Its IUPAC name is [(7R)-2,7-diamino-6-oxo-8-phenyloctyl]phosphonic acid.
| Compound Name | [(7R)-2,7-diamino-6-oxo-8-phenyloctyl]phosphonic acid |
|---|---|
| PubChem CID | 70545488 |
| Molecular Formula | C14H23N2O4P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | [(7R)-2,7-diamino-6-oxo-8-phenyloctyl]phosphonic acid |
| SMILES | NC(CCCC(=O)[C@H](N)Cc1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C14H23N2O4P/c15-12(10-21(18,19)20)7-4-8-14(17)13(16)9-11-5-2-1-3-6-11/h1-3,5-6,12-13H,4,7-10,15-16H2,(H2,18,19,20)/t12?,13-/m1/s1 |
| InChIKey | WITJLFDOIDGKLG-ZGTCLIOFSA-N |
| XLogP | 0.80 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|