C24H35N5O6S — CID 144727349
ethane;S-[2-[[2-[[2-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate (PubChem CID 144727349) has the molecular formula C24H35N5O6S and a molecular weight of 521.64 g/mol. Its IUPAC name is ethane;S-[2-[[2-[[2-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate.
| Compound Name | ethane;S-[2-[[2-[[2-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate |
|---|---|
| PubChem CID | 144727349 |
| Molecular Formula | C24H35N5O6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | ethane;S-[2-[[2-[[2-[[2-[3-(2-methylprop-2-enoylamino)propylamino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl]amino]-2-oxoethyl] benzenecarbothioate |
| SMILES | C=C(C)C(=O)NCCCNC(=O)CNC(=O)CNC(=O)CNC(=O)CSC(=O)c1ccccc1.CC |
| InChI | InChI=1S/C22H29N5O6S.C2H6/c1-15(2)21(32)24-10-6-9-23-17(28)11-25-18(29)12-26-19(30)13-27-20(31)14-34-22(33)16-7-4-3-5-8-16;1-2/h3-5,7-8H,1,6,9-14H2,2H3,(H,23,28)(H,24,32)(H,25,29)(H,26,30)(H,27,31);1-2H3 |
| InChIKey | SBBFHYDMCUXQQC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 162.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|