C21H22N2O3 — CID 141452779
N-(4-benzoylphenyl)-4-(2-methylprop-2-enoylamino)butanamide (PubChem CID 141452779) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-4-(2-methylprop-2-enoylamino)butanamide.
| Compound Name | N-(4-benzoylphenyl)-4-(2-methylprop-2-enoylamino)butanamide |
|---|---|
| PubChem CID | 141452779 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(4-benzoylphenyl)-4-(2-methylprop-2-enoylamino)butanamide |
| SMILES | C=C(C)C(=O)NCCCC(=O)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-15(2)21(26)22-14-6-9-19(24)23-18-12-10-17(11-13-18)20(25)16-7-4-3-5-8-16/h3-5,7-8,10-13H,1,6,9,14H2,2H3,(H,22,26)(H,23,24) |
| InChIKey | NEDURZDXITXYDC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|