C15H20N2O3 — CID 162677801
6-(2-oxopropanoylamino)-N-phenylhexanamide (PubChem CID 162677801) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-(2-oxopropanoylamino)-N-phenylhexanamide.
| Compound Name | 6-(2-oxopropanoylamino)-N-phenylhexanamide |
|---|---|
| PubChem CID | 162677801 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 6-(2-oxopropanoylamino)-N-phenylhexanamide |
| SMILES | CC(=O)C(=O)NCCCCCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3/c1-12(18)15(20)16-11-7-3-6-10-14(19)17-13-8-4-2-5-9-13/h2,4-5,8-9H,3,6-7,10-11H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | YOQBWVSOCXMEHJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|