C30H47N5O6 — CID 118017030
6-[[2-[[2-oxo-2-(6-oxoheptylamino)ethyl]-[2-oxo-2-(4-oxopentylamino)ethyl]amino]acetyl]amino]-N-phenylhexanamide (PubChem CID 118017030) has the molecular formula C30H47N5O6 and a molecular weight of 573.74 g/mol. Its IUPAC name is 6-[[2-[[2-oxo-2-(6-oxoheptylamino)ethyl]-[2-oxo-2-(4-oxopentylamino)ethyl]amino]acetyl]amino]-N-phenylhexanamide.
| Compound Name | 6-[[2-[[2-oxo-2-(6-oxoheptylamino)ethyl]-[2-oxo-2-(4-oxopentylamino)ethyl]amino]acetyl]amino]-N-phenylhexanamide |
|---|---|
| PubChem CID | 118017030 |
| Molecular Formula | C30H47N5O6 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | 6-[[2-[[2-oxo-2-(6-oxoheptylamino)ethyl]-[2-oxo-2-(4-oxopentylamino)ethyl]amino]acetyl]amino]-N-phenylhexanamide |
| SMILES | CC(=O)CCCCCNC(=O)CN(CC(=O)NCCCCCC(=O)Nc1ccccc1)CC(=O)NCCCC(C)=O |
| InChI | InChI=1S/C30H47N5O6/c1-24(36)13-6-4-10-18-31-28(39)21-35(23-30(41)33-20-12-14-25(2)37)22-29(40)32-19-11-5-9-17-27(38)34-26-15-7-3-8-16-26/h3,7-8,15-16H,4-6,9-14,17-23H2,1-2H3,(H,31,39)(H,32,40)(H,33,41)(H,34,38) |
| InChIKey | TYOUAANPTCKECX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|