C37H66B4N12O10 — CID 168891726
CID 168891726 (PubChem CID 168891726) has the molecular formula C37H66B4N12O10 and a molecular weight of 882.26 g/mol.
| Compound Name | CID 168891726 |
|---|---|
| PubChem CID | 168891726 |
| Molecular Formula | C37H66B4N12O10 |
| Molecular Weight | 882.26 g/mol |
| Exact Mass | 882.54 |
| IUPAC Name | — |
| SMILES | CC.[B]NC(=O)CN(CC(=O)N[B])CC(=O)NCCCCCNC(=O)CN(CC(=O)NCCCCCNC(=O)CN(CC(=O)N[B])CC(=O)N[B])CC(=O)NCCCCCC(C)=O |
| InChI | InChI=1S/C35H60B4N12O10.C2H6/c1-26(52)11-5-2-6-12-40-27(53)17-49(18-28(54)41-13-7-3-9-15-43-30(56)20-50(22-32(58)45-36)23-33(59)46-37)19-29(55)42-14-8-4-10-16-44-31(57)21-51(24-34(60)47-38)25-35(61)48-39;1-2/h2-25H2,1H3,(H,40,53)(H,41,54)(H,42,55)(H,43,56)(H,44,57)(H,45,58)(H,46,59)(H,47,60)(H,48,61);1-2H3 |
| InChIKey | PKIPNDNAISENQT-UHFFFAOYSA-N |
| XLogP | -5.21 |
| TPSA | 288.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.26 |
| LogP ≤ 5 | -5.21 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|