C38H64B4N10O10 — CID 174074733
CID 174074733 (PubChem CID 174074733) has the molecular formula C38H64B4N10O10 and a molecular weight of 864.24 g/mol.
| Compound Name | CID 174074733 |
|---|---|
| PubChem CID | 174074733 |
| Molecular Formula | C38H64B4N10O10 |
| Molecular Weight | 864.24 g/mol |
| Exact Mass | 864.52 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)CCC[C@@H](NC(=O)CCCCCNC(=O)CN(CC(=O)NCCCCCC(=O)CC)CC(=O)NCCCCCC(=O)N[C@H](CCCC(=O)N[B])C(=O)N[B])C(=O)N[B] |
| InChI | InChI=1S/C38H64B4N10O10/c1-2-27(53)14-6-3-9-21-43-34(58)24-52(25-35(59)44-22-10-4-7-17-30(54)46-28(37(61)50-41)15-12-19-32(56)48-39)26-36(60)45-23-11-5-8-18-31(55)47-29(38(62)51-42)16-13-20-33(57)49-40/h28-29H,2-26H2,1H3,(H,43,58)(H,44,59)(H,45,60)(H,46,54)(H,47,55)(H,48,56)(H,49,57)(H,50,61)(H,51,62)/t28-,29-/m1/s1 |
| InChIKey | OEQGGXLHZKUWQB-FQLXRVMXSA-N |
| XLogP | -2.59 |
| TPSA | 282.21 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.24 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|