C18H30B2N4O5 — CID 168891729
CID 168891729 (PubChem CID 168891729) has the molecular formula C18H30B2N4O5 and a molecular weight of 404.09 g/mol.
| Compound Name | CID 168891729 |
|---|---|
| PubChem CID | 168891729 |
| Molecular Formula | C18H30B2N4O5 |
| Molecular Weight | 404.09 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | — |
| SMILES | [B]NC(=O)CN(CC(=O)N[B])C(=O)CCCCC(=O)NCCCCCC(=O)CC |
| InChI | InChI=1S/C18H30B2N4O5/c1-2-14(25)8-4-3-7-11-21-15(26)9-5-6-10-18(29)24(12-16(27)22-19)13-17(28)23-20/h2-13H2,1H3,(H,21,26)(H,22,27)(H,23,28) |
| InChIKey | RZPSOKPFPPFKAZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.09 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|