C16H29N3O4 — CID 160754701
N-methyl-2-[2-oxobutyl-[2-oxo-2-(6-oxoheptylamino)ethyl]amino]acetamide (PubChem CID 160754701) has the molecular formula C16H29N3O4 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-methyl-2-[2-oxobutyl-[2-oxo-2-(6-oxoheptylamino)ethyl]amino]acetamide.
| Compound Name | N-methyl-2-[2-oxobutyl-[2-oxo-2-(6-oxoheptylamino)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 160754701 |
| Molecular Formula | C16H29N3O4 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-methyl-2-[2-oxobutyl-[2-oxo-2-(6-oxoheptylamino)ethyl]amino]acetamide |
| SMILES | CCC(=O)CN(CC(=O)NC)CC(=O)NCCCCCC(C)=O |
| InChI | InChI=1S/C16H29N3O4/c1-4-14(21)10-19(11-15(22)17-3)12-16(23)18-9-7-5-6-8-13(2)20/h4-12H2,1-3H3,(H,17,22)(H,18,23) |
| InChIKey | STSDWGNDECRJDK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|