C16H19NO4S — CID 86735054
(2S)-1-(4-benzoylsulfanylbutanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 86735054) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is (2S)-1-(4-benzoylsulfanylbutanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(4-benzoylsulfanylbutanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86735054 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (2S)-1-(4-benzoylsulfanylbutanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(SCCCC(=O)N1CCC[C@H]1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H19NO4S/c18-14(17-10-4-8-13(17)15(19)20)9-5-11-22-16(21)12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-11H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | YUCWECHOCFOBTK-ZDUSSCGKSA-N |
| XLogP | 2.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|